CAS 383142-95-8 appears in our catalog under these names: 4-(3-Methoxyphenyl)-1,3-thiazole-2-carbaldehyde, 95%, 4-(3-Methoxyphenyl)-1,3-thiazole-2-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
4-(3-methoxyphenyl)-1,3-thiazole-2-carbaldehyde (CAS 383142-95-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 4-(3-methoxyphenyl)-1,3-thiazole-2-carbaldehyde. InChIKey: NYMXOZKXPMPIJD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | NYMXOZKXPMPIJD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CSC(=N2)C=O |
Computed by PubChem (NCBI)