CAS 36916-44-6 is the registry number for 2-Benzyl-1,3-thiazole-4-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-benzyl-1,3-thiazole-4-carboxylic acid (CAS 36916-44-6) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-benzyl-1,3-thiazole-4-carboxylic acid. InChIKey: OUVVHURAIHESSK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-benzyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | OUVVHURAIHESSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)