CAS 123971-35-7 appears in our catalog under these names: 2-Thiazolecarboxylic acid, 4-(4-methylphenyl)-, 98%, 4-(p-Tolyl)thiazole-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(4-methylphenyl)-1,3-thiazole-2-carboxylic acid (CAS 123971-35-7) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 4-(4-methylphenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: RLNRIJRPTDSEKD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | RLNRIJRPTDSEKD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)