CAS 1820649-66-8 is the registry number for methyl 2-(thiophen-2-yl)pyridine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-thiophen-2-ylpyridine-4-carboxylate (CAS 1820649-66-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: methyl 2-thiophen-2-ylpyridine-4-carboxylate. InChIKey: WUVILBJLJTXXMR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | methyl 2-thiophen-2-ylpyridine-4-carboxylate |
| InChIKey | WUVILBJLJTXXMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)