CAS 1261236-29-6 is the registry number for 4-(3-Methyl-isothiazol-5-yl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3-methyl-1,2-thiazol-5-yl)benzoic acid (CAS 1261236-29-6) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 4-(3-methyl-1,2-thiazol-5-yl)benzoic acid. InChIKey: AQNUMPFWFDRHHK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-(3-methyl-1,2-thiazol-5-yl)benzoic acid |
| InChIKey | AQNUMPFWFDRHHK-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)