CAS 2170-13-0 appears in our catalog under these names: 4–Biphenyl Benzoate, 4-Biphenyl Benzoate, >98.0%(GC), (4-Phenylphenyl) benzoate, 99%, 99%, (4-Phenylphenyl) benzoate, 98%, (4-Phenylphenyl) benzoate, 99%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 50g, 100g.
(4-phenylphenyl) benzoate (CAS 2170-13-0) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: (4-phenylphenyl) benzoate. InChIKey: CINHWMYRCOGYIX-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (4-phenylphenyl) benzoate |
| InChIKey | CINHWMYRCOGYIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)