CAS 6051-86-1 appears in our catalog under these names: Alpha-naphthoflavanone, 95%, α-Naphthoflavanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2-phenyl-2,3-dihydrobenzo[h]chromen-4-one (CAS 6051-86-1) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: 2-phenyl-2,3-dihydrobenzo[h]chromen-4-one. InChIKey: QEVIKVQRCYXXSA-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 2-phenyl-2,3-dihydrobenzo[h]chromen-4-one |
| InChIKey | QEVIKVQRCYXXSA-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=CC3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)