CAS 2860-03-9 is the registry number for Beta-naphthoflavanone, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-phenyl-2,3-dihydrobenzo[f]chromen-1-one (CAS 2860-03-9) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: 3-phenyl-2,3-dihydrobenzo[f]chromen-1-one. InChIKey: XTWSWGKXWMYSLP-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 3-phenyl-2,3-dihydrobenzo[f]chromen-1-one |
| InChIKey | XTWSWGKXWMYSLP-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C3=CC=CC=C3C=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)