CAS 5449-49-0 appears in our catalog under these names: (2-Phenylphenyl) benzoate, 95%, (1,1'-Biphenyl)-2-yl benzoate, 97%, (2-phenylphenyl) benzoate, 97%, 97%, (2-PHENYLPHENYL) BENZOATE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(2-phenylphenyl) benzoate (CAS 5449-49-0) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: (2-phenylphenyl) benzoate. InChIKey: OLPCSEIDQQDELO-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (2-phenylphenyl) benzoate |
| InChIKey | OLPCSEIDQQDELO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)