Products 71432-05-8
CAS 71432-05-8 appears in our catalog under these names: Alpha-(Phenylmethylene)-1-naphthaleneacetic Acid, a-(Phenylmethylene)-1-naphthaleneacetic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(Z)-2-naphthalen-1-yl-3-phenylprop-2-enoic acid (CAS 71432-05-8) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: (Z)-2-naphthalen-1-yl-3-phenylprop-2-enoic acid. InChIKey: WDTPMTWSUDHDGR-AQTBWJFISA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (Z)-2-naphthalen-1-yl-3-phenylprop-2-enoic acid |
| InChIKey | WDTPMTWSUDHDGR-AQTBWJFISA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C2=CC=CC3=CC=CC=C32)\C(=O)O |
Computed by PubChem (NCBI)