CAS 192703-61-0 is the registry number for 5-Methyl-1,2-chrysenediol. Offered by: TRC. Available pack sizes: 50mg.
5-methylchrysene-1,2-diol (CAS 192703-61-0) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: 5-methylchrysene-1,2-diol. InChIKey: HWSXRBHBDLAFCA-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 5-methylchrysene-1,2-diol |
| InChIKey | HWSXRBHBDLAFCA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC=CC=C2C3=C1C4=C(C=C3)C(=C(C=C4)O)O |
Computed by PubChem (NCBI)