Products 6317-73-3
CAS 6317-73-3 appears in our catalog under these names: 4-Phenoxybenzophenone, 95%, 4-Phenoxybenzophenone, 4-Phenoxybenzophenone, >95.0%(GC), (4-Phenoxyphenyl)(phenyl)methanone 98%, (4-Phenoxyphenyl)(phenyl)methanone, 98%, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 250g, 500g, 250mg.
(4-phenoxyphenyl)-phenylmethanone (CAS 6317-73-3) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: (4-phenoxyphenyl)-phenylmethanone. InChIKey: ITVUPWDTDWMACZ-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (4-phenoxyphenyl)-phenylmethanone |
| InChIKey | ITVUPWDTDWMACZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)