cas: 1072951-39-3 — see every product listed under this CAS number, including other names
(5-(((tert-Butoxycarbonyl)amino)methyl)thiophen-2-yl)boronic acid 98% (CAS 1072951-39-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145022-1g |
| cas | 1072951-39-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 904.38 Pln | |
| Ambeed | 25g | 4052.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1145022 |
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid (CAS 1072951-39-3) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid. InChIKey: LCYICDNCCZCYQI-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid |
| InChIKey | LCYICDNCCZCYQI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)