cas: 874289-44-8 — see every product listed under this CAS number, including other names
(5-(Cyclohexylcarbamoyl)-2-fluorophenyl)boronic acid, 98% (CAS 874289-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216156-100MG |
| cas | 874289-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 653.95 Pln | |
| Fluorochem | 250mg | 945.52 Pln | |
| Fluorochem | 1g | 2252.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-44-8) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: YASQSGZTGZDSLB-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | [5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | YASQSGZTGZDSLB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)