CAS 874289-44-8 appears in our catalog under these names: 5-(Cyclohexylcarbamoyl)-2-fluorophenylboronic acid, 98%, (5–(Cyclohexylcarbamoyl)–2–fluorophenyl)boronic acid, (5-(Cyclohexylcarbamoyl)-2-fluorophenyl)boronic acid 98%, 5-(Cyclohexylcarbamoyl)-2-fluorophenylboronic acid, 98%, 98%, (5-(Cyclohexylcarbamoyl)-2-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-44-8) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: YASQSGZTGZDSLB-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | [5-(cyclohexylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | YASQSGZTGZDSLB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)