CAS 2096336-16-0 is the registry number for 3–Fluoro–5–(2–methyl–1–piperidinylcarbonyl)benzeneboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
[3-fluoro-5-(2-methylpiperidine-1-carbonyl)phenyl]boronic acid (CAS 2096336-16-0) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [3-fluoro-5-(2-methylpiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: FOZKXTAGQOGLLH-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | [3-fluoro-5-(2-methylpiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | FOZKXTAGQOGLLH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)N2CCCCC2C)(O)O |
Computed by PubChem (NCBI)