Products 2096333-57-0
CAS 2096333-57-0 is the registry number for 2-Carbamoyl-6-fluorophenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2096333-57-0) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: 3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: MVLAKOBLQXCZNQ-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | MVLAKOBLQXCZNQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2F)C(=O)N |
Computed by PubChem (NCBI)