CAS 1449132-53-9 is the registry number for 3–Fluoro–4–(4–methylpiperidine–1–carbonyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-fluoro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid (CAS 1449132-53-9) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [3-fluoro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: NTDBICSBLSVBSL-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | [3-fluoro-4-(4-methylpiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | NTDBICSBLSVBSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N2CCC(CC2)C)F)(O)O |
Computed by PubChem (NCBI)