Products 874219-42-8

CAS 874219-42-8 is the registry number for 3-(Cyclohexylcarbamoyl)-5-fluorophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid (CAS 874219-42-8) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid. InChIKey: DYUMHPWTMLPIFV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BFNO3
Molecular weight265.09 g/mol
IUPAC name[3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid
InChIKeyDYUMHPWTMLPIFV-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)F)C(=O)NC2CCCCC2)(O)O

Computed by PubChem (NCBI)