Products 874219-42-8
CAS 874219-42-8 is the registry number for 3-(Cyclohexylcarbamoyl)-5-fluorophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid (CAS 874219-42-8) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: [3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid. InChIKey: DYUMHPWTMLPIFV-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | [3-(cyclohexylcarbamoyl)-5-fluorophenyl]boronic acid |
| InChIKey | DYUMHPWTMLPIFV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)