CAS 1105052-78-5 is the registry number for N-[2-Fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide (CAS 1105052-78-5) is a chemical compound with the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. IUPAC name: N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide. InChIKey: BAGSBTIRPKNCQB-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide |
| InChIKey | BAGSBTIRPKNCQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC=O)F |
Computed by PubChem (NCBI)