(5-(Trifluoromethyl)pyridin-2-yl)boronic acid 95%
cas: 1162257-58-0 — see every product listed under this CAS number, including other names
(5-(Trifluoromethyl)pyridin-2-yl)boronic acid 95% (CAS 1162257-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138006-100mg |
| cas | 1162257-58-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 1087.94 Pln | |
| Ambeed | 5g | 3641.12 Pln | |
| Ambeed | 25g | 12574.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138006 |
[5-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 1162257-58-0) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: QGHRRKVXTZBZFZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [5-(trifluoromethyl)-2-pyridinyl]boronic acid |
| InChIKey | QGHRRKVXTZBZFZ-UHFFFAOYSA-N |
| SMILES | B(C1=NC=C(C=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(Trifluoromethyl)pyridine-2-boronic acid, (5-(Trifluoromethyl)pyridin-2-yl)boronic acid, 5-(trifluoromethyl)pyridin-2-ylboronic acid, [5-(trifluoromethyl)pyridin-2-yl]boronic acid, Boronic acid, B-[5-(trifluoromethyl)-2-pyridinyl]-, [5-(trifluoromethyl)-2-pyridyl]boronic acid, 5-(Trifluoromethyl)pyridin-2-boronic acid, QGHRRKVXTZBZFZ-UHFFFAOYSA-N, (5-(Trifluoromethyl)pyridin-2-yl)boronicacid