CAS 870459-90-8 appears in our catalog under these names: 4-Trifluoromethylpyridine-2-boronic acid, 95%, (4-(Trifluoromethyl)pyridin-2-yl)boronic Acid, (4–(Trifluoromethyl)pyridin–2–yl)boronic acid, (4-(Trifluoromethyl)pyridin-2-yl)boronic acid 97%, [4-(Trifluoromethyl)-2-pyridinyl]boronic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
[4-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 870459-90-8) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [4-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: KJFNGXQZOZOTHA-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [4-(trifluoromethyl)-2-pyridinyl]boronic acid |
| InChIKey | KJFNGXQZOZOTHA-UHFFFAOYSA-N |
| SMILES | B(C1=NC=CC(=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)