Products 1162257-58-0

CAS 1162257-58-0 appears in our catalog under these names: 5-(Trifluoromethyl)pyridine-2-boronic acid, 95%, (5–(Trifluoromethyl)pyridin–2–yl)boronic acid, (5-(Trifluoromethyl)pyridin-2-yl)boronic acid 95%, 5-(Trifluoromethyl)pyridine-2-boronic Acid, 95%, 95%, (5-(Trifluoromethyl)pyridin-2-yl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg, 25g.

Structural formula: {0} (CAS {1})

[5-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 1162257-58-0) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: QGHRRKVXTZBZFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BF3NO2
Molecular weight190.92 g/mol
IUPAC name[5-(trifluoromethyl)-2-pyridinyl]boronic acid
InChIKeyQGHRRKVXTZBZFZ-UHFFFAOYSA-N
SMILESB(C1=NC=C(C=C1)C(F)(F)F)(O)O

Computed by PubChem (NCBI)