cas: 1162257-58-0 — see every product listed under this CAS number, including other names
(5–(Trifluoromethyl)pyridin–2–yl)boronic acid (CAS 1162257-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF51479-100mg |
| cas | 1162257-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 601.72 Pln | |
| GLPBio | 1g | 1154.02 Pln | |
| GLPBio | 250mg | 714.05 Pln | |
| GLPBio | 50mg | 536.19 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[5-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 1162257-58-0) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [5-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: QGHRRKVXTZBZFZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [5-(trifluoromethyl)-2-pyridinyl]boronic acid |
| InChIKey | QGHRRKVXTZBZFZ-UHFFFAOYSA-N |
| SMILES | B(C1=NC=C(C=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)