CAS 868662-36-6 appears in our catalog under these names: 2-Trifluoromethylpyridine-5-boronic acid, 98%, 2-(Trifluoromethyl)pyridine-5-boronic acid, 98% , 2-(Trifluoromethyl)pyridine-5-boronic Acid (contains varying amounts of Anhydride), (6-(Trifluoromethyl)pyridin-3-yl)boronic acid 98%, 2-Trifluoromethyl-5-Pyridineboronic Acid, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg.
[6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 868662-36-6) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: BNTIPMNMTIAWIW-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | BNTIPMNMTIAWIW-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)