CAS 947533-39-3 appears in our catalog under these names: 2-(Trifluoromethyl)pyridine-3-boronic acid, 97%, (2-(Trifluoromethyl)pyridin-3-yl)boronic acid 98%, (2-(Trifluoromethyl)pyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 10g, 100mg, 500mg.
[2-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 947533-39-3) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [2-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: RWKHOCBPUSCGAW-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [2-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | RWKHOCBPUSCGAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)