CAS 1093407-58-9 appears in our catalog under these names: 2-(Trifluoromethyl)pyridine-4-boronic acid, 95%, (2-(Trifluoromethyl)pyridin-4-yl)boronic acid 98%, (2-(Trifluoromethyl)pyridin-4-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 10g.
[2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 1093407-58-9) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: PHLLTVDZCKUNJN-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | PHLLTVDZCKUNJN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)