cas: 2096339-65-8 — see every product listed under this CAS number, including other names
(5-Bromo-2,3-difluorophenyl)boronic acid 97% (CAS 2096339-65-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A549617-250mg |
| cas | 2096339-65-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 1688.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A549617 |
(5-bromo-2,3-difluorophenyl)boronic acid (CAS 2096339-65-8) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (5-bromo-2,3-difluorophenyl)boronic acid. InChIKey: WMJVJEUQKZBXHN-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (5-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | WMJVJEUQKZBXHN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)