(5-Bromo-2,4-difluorophenyl)boronic acid, 98%, 98%
cas: 2096331-76-7 — see every product listed under this CAS number, including other names
(5-Bromo-2,4-difluorophenyl)boronic acid, 98%, 98% (CAS 2096331-76-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHMM-250mg |
| cas | 2096331-76-7 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 645.20 Pln | |
| Chemat | 100g | 2402.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5-bromo-2,4-difluorophenyl)boronic acid (CAS 2096331-76-7) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (5-bromo-2,4-difluorophenyl)boronic acid. InChIKey: SZHYLLMQYYMZFL-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (5-bromo-2,4-difluorophenyl)boronic acid |
| InChIKey | SZHYLLMQYYMZFL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(5-bromo-2,4-difluorophenyl)boronic acid, 2,4-Difluoro-5-bromophenylboronic acid, 5-Bromo-2,4-difluorobenzeneboronic acid, (5-bromo-2,4-difluorophenyl)boronicacid, (5-bromo-2,4-difluoro-phenyl)boronic acid, 5-Bromo-2,4-difluorobenzeneboronic acid 98%, Boronic acid, B-(5-bromo-2,4-difluorophenyl)-