(5-Chloro-2-fluoro-4-methoxyphenyl)boronic acid, 98%
cas: 1072952-18-1 — see every product listed under this CAS number, including other names
(5-Chloro-2-fluoro-4-methoxyphenyl)boronic acid, 98% (CAS 1072952-18-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A208942-250mg |
| cas | 1072952-18-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1138.00 Pln | |
| Ambeed | 5g | 3880.31 Pln | |
| Ambeed | 10g | 6728.31 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| Chemat | 5g | 5267.60 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 642.02 Pln | |
| BLDpharm | 1g | 1225.15 Pln | |
| BLDpharm | 5g | 4179.66 Pln | |
| BLDpharm | 10g | 7245.25 Pln | |
| Fluorochem | 100mg | 883.04 Pln | |
| Fluorochem | 5g | 9603.93 Pln | |
| Fluorochem | 250mg | 1419.31 Pln | |
| Fluorochem | 1g | 2830.27 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(5-chloro-2-fluoro-4-methoxyphenyl)boronic acid (CAS 1072952-18-1) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (5-chloro-2-fluoro-4-methoxyphenyl)boronic acid. InChIKey: CUIYIOBADMFFLL-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (5-chloro-2-fluoro-4-methoxyphenyl)boronic acid |
| InChIKey | CUIYIOBADMFFLL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Chloro-2-fluoro-4-methoxyphenylboronic acid, (5-chloro-2-fluoro-4-methoxyphenyl)boronic acid, (5-chloro-2-fluoro-4-methoxy-phenyl)boronic acid, (5-chloro-2-fluoro-4-methoxyphenyl)boronicacid, 5-chloro-2-fluoro-4-methoxybenzeneboronic acid, (5-Chloro-2-fluoro-4-methoxyphenyl)boronic acid - [C90125]