(5-Fluoro-2-propoxyphenyl)boronic acid 98%
cas: 480438-73-1 — see every product listed under this CAS number, including other names
(5-Fluoro-2-propoxyphenyl)boronic acid 98% (CAS 480438-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A393869-1g |
| cas | 480438-73-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 10g | 2061.38 Pln | |
| Ambeed | 25g | 3396.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A393869 |
(5-fluoro-2-propoxyphenyl)boronic acid (CAS 480438-73-1) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (5-fluoro-2-propoxyphenyl)boronic acid. InChIKey: TVQRNJJJJCUOLL-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (5-fluoro-2-propoxyphenyl)boronic acid |
| InChIKey | TVQRNJJJJCUOLL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCCC)(O)O |
Computed by PubChem (NCBI)