cas: 2247773-27-7 — see every product listed under this CAS number, including other names
(6-(Trifluoromethoxy)pyridin-3-yl)methanamine hydrochloride, 97% (CAS 2247773-27-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1380867-250mg |
| cas | 2247773-27-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 10310.23 Pln | |
| AmBeed | 5g | 76914.04 Pln | |
| AmBeed | 1g | 25628.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[6-(trifluoromethoxy)-3-pyridinyl]methanamine;hydrochloride (CAS 2247773-27-7) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [6-(trifluoromethoxy)-3-pyridinyl]methanamine;hydrochloride. InChIKey: SBUYADLJNRNZGK-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [6-(trifluoromethoxy)-3-pyridinyl]methanamine;hydrochloride |
| InChIKey | SBUYADLJNRNZGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CN)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)