cas: 6642-34-8 — see every product listed under this CAS number, including other names
(6-Bromobenzo[d][1,3]dioxol-5-yl)methanol, 95%, 95% (CAS 6642-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FA25-100mg |
| cas | 6642-34-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 774.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(6-bromo-1,3-benzodioxol-5-yl)methanol (CAS 6642-34-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (6-bromo-1,3-benzodioxol-5-yl)methanol. InChIKey: XYYBAJXSNPIXTC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (6-bromo-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XYYBAJXSNPIXTC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)Br |
Computed by PubChem (NCBI)