cas: 6642-34-8 — see every product listed under this CAS number, including other names
(6-Bromobenzo[d][1,3]dioxol-5-yl)methanol, 98% (CAS 6642-34-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216586-250MG |
| cas | 6642-34-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1263.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-bromo-1,3-benzodioxol-5-yl)methanol (CAS 6642-34-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (6-bromo-1,3-benzodioxol-5-yl)methanol. InChIKey: XYYBAJXSNPIXTC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (6-bromo-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XYYBAJXSNPIXTC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)Br |
Computed by PubChem (NCBI)