cas: 915922-16-6 — see every product listed under this CAS number, including other names
(6-Fluoro-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid, 95+%, 95+% (CAS 915922-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTQR-100mg |
| cas | 915922-16-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 434.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid (CAS 915922-16-6) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid. InChIKey: KKGBSHPZFPPKHD-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid |
| InChIKey | KKGBSHPZFPPKHD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C2CC(=O)O |
Computed by PubChem (NCBI)