CAS 143654-63-1 is the registry number for 5-Fluoro-8-nitro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-8-nitro-3,4-dihydro-2H-naphthalen-1-one (CAS 143654-63-1) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 5-fluoro-8-nitro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: VTHOHONRMLWGNM-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 5-fluoro-8-nitro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | VTHOHONRMLWGNM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2C(=O)C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)