CAS 915920-32-0 appears in our catalog under these names: (5-Fluoro-2-oxo-2,3-dihydro-1h-indol-3-yl)acetic acid, 95%, 2-(5-Fluoro-2-oxoindolin-3-yl)acetic acid, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g.
2-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid (CAS 915920-32-0) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 2-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid. InChIKey: GOJAJUSLXBXIJY-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 2-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid |
| InChIKey | GOJAJUSLXBXIJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)