Products 958891-05-9
CAS 958891-05-9 appears in our catalog under these names: 3-(3-Fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid, 95%, 3-(3-Fluorophenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%, 3-(3-Fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 958891-05-9) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: TXCSUIQCEFRHID-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | TXCSUIQCEFRHID-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)