CAS 1822818-28-9 is the registry number for 3-Amino-4-fluoro-benzofuran-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
Methyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate (CAS 1822818-28-9) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: methyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate. InChIKey: XBZVPFZYCSULSQ-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | methyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate |
| InChIKey | XBZVPFZYCSULSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C=CC=C2F)N |
Computed by PubChem (NCBI)