Products 1822818-28-9

CAS 1822818-28-9 is the registry number for 3-Amino-4-fluoro-benzofuran-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate (CAS 1822818-28-9) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: methyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate. InChIKey: XBZVPFZYCSULSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FNO3
Molecular weight209.17 g/mol
IUPAC namemethyl 3-amino-4-fluoro-1-benzofuran-2-carboxylate
InChIKeyXBZVPFZYCSULSQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=C(O1)C=CC=C2F)N

Computed by PubChem (NCBI)