Products 869722-33-8

CAS 869722-33-8 is the registry number for 6-Fluoro-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (CAS 869722-33-8) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid. InChIKey: PXJPYWRFHOWZQA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FNO3
Molecular weight209.17 g/mol
IUPAC name6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid
InChIKeyPXJPYWRFHOWZQA-UHFFFAOYSA-N
SMILESC1C(C2=C(C=CC(=C2)F)NC1=O)C(=O)O

Computed by PubChem (NCBI)