CAS 915922-16-6 appears in our catalog under these names: (6-Fluoro-2-oxo-2,3-dihydro-1h-indol-3-yl)acetic acid, 95%, (6-Fluoro-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid, 95+%, 95+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid (CAS 915922-16-6) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid. InChIKey: KKGBSHPZFPPKHD-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 2-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)acetic acid |
| InChIKey | KKGBSHPZFPPKHD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C2CC(=O)O |
Computed by PubChem (NCBI)