cas: 15341-08-9 — see every product listed under this CAS number, including other names
(6-Nitrobenzo[d][1,3]dioxol-5-yl)methanol, 95% (CAS 15341-08-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F731452-5G |
| cas | 15341-08-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 914.28 Pln | |
| Fluorochem | 25g | 1924.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6-nitro-1,3-benzodioxol-5-yl)methanol (CAS 15341-08-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: (6-nitro-1,3-benzodioxol-5-yl)methanol. InChIKey: XSKQKDTZQNFCCB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | (6-nitro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XSKQKDTZQNFCCB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)