cas: 15341-08-9 — see every product listed under this CAS number, including other names
(6-Nitrobenzo[d][1,3]dioxol-5-yl)methanol, 98%, 98% (CAS 15341-08-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NBH-1g |
| cas | 15341-08-9 |
| size | 1g |
| availability | 49g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 10g | 909.20 Pln | |
| Chemat | 25g | 1178.00 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6-nitro-1,3-benzodioxol-5-yl)methanol (CAS 15341-08-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: (6-nitro-1,3-benzodioxol-5-yl)methanol. InChIKey: XSKQKDTZQNFCCB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | (6-nitro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XSKQKDTZQNFCCB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)