cas: 101990-68-5 — see every product listed under this CAS number, including other names
(6-Phenoxypyridin-3-yl)methanol, 95+%, 95+% (CAS 101990-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11177K-100mg |
| cas | 101990-68-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1283.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(6-phenoxy-3-pyridinyl)methanol (CAS 101990-68-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (6-phenoxy-3-pyridinyl)methanol. InChIKey: ZAKRVFYNLKKPOF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (6-phenoxy-3-pyridinyl)methanol |
| InChIKey | ZAKRVFYNLKKPOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)CO |
Computed by PubChem (NCBI)