Products 5441-73-6
CAS 5441-73-6 appears in our catalog under these names: 2-Methyl-5-phenyl-1h-pyrrole-3-carboxylic acid, 95%, 2-Methyl-5-phenyl-1H-pyrrole-3-carboxylic acid, 97%, 2-Methyl-5-phenyl-1H-pyrrole-3-carboxylic acid, 2-Methyl-5-phenyl-1H-pyrrole-3-carboxylic acid 95%, 2-Methyl-5-phenyl-1H-pyrrole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g, 100mg.
2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid (CAS 5441-73-6) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid. InChIKey: XDXKXRVCTYULQN-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
| InChIKey | XDXKXRVCTYULQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)