cas: 299430-87-8 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (2-(2-hydroxyethoxy)ethyl)carbamate, 97%, 97% (CAS 299430-87-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G9K-1g |
| cas | 299430-87-8 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 15g | 323.60 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 100g | 1552.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate (CAS 299430-87-8) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate. InChIKey: DUVHQSUZTXSLMW-UHFFFAOYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| InChIKey | DUVHQSUZTXSLMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCO |
Computed by PubChem (NCBI)