cas: 299430-87-8 — see every product listed under this CAS number, including other names
9H-Fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate, 98% (CAS 299430-87-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F402251-1G |
| cas | 299430-87-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 674.78 Pln | |
| Fluorochem | 50g | 1294.35 Pln | |
| Fluorochem | 100g | 2533.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate (CAS 299430-87-8) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate. InChIKey: DUVHQSUZTXSLMW-UHFFFAOYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| InChIKey | DUVHQSUZTXSLMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCO |
Computed by PubChem (NCBI)