cas: 209115-33-3 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (5-hydroxypentyl)carbamate, 97%, 97% (CAS 209115-33-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113K2Z-100mg |
| cas | 209115-33-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 10g | 842.00 Pln | |
| Chemat | 25g | 1624.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate (CAS 209115-33-3) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate. InChIKey: YNOWFUNORLDFTH-UHFFFAOYSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate |
| InChIKey | YNOWFUNORLDFTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCO |
Computed by PubChem (NCBI)