cas: 209115-33-3 — see every product listed under this CAS number, including other names
FmocNH-C5-OH 95% (CAS 209115-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412875-250mg |
| cas | 209115-33-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 2072.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A412875 |
9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate (CAS 209115-33-3) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate. InChIKey: YNOWFUNORLDFTH-UHFFFAOYSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate |
| InChIKey | YNOWFUNORLDFTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCO |
Computed by PubChem (NCBI)