cas: 886510-13-0 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 3-hydroxyazetidine-1-carboxylate (CAS 886510-13-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119A5I-250mg |
| cas | 886510-13-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 5g | 1518.80 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| Chemat | 25g | 4778.00 Pln |
| delivery time | 3 weeks |
|---|
9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate (CAS 886510-13-0) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate. InChIKey: YAEMQXJRXHCWDV-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate |
| InChIKey | YAEMQXJRXHCWDV-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)